Structure of PDB 6ucb Chain D Binding Site BS01 |
|
|
Ligand ID | ZK1 |
InChI | InChI=1S/C14H15F3N3O6P/c15-14(16,17)8-5-9-11(6-10(8)19-1-3-26-4-2-19)20(7-27(23,24)25)13(22)12(21)18-9/h5-6H,1-4,7H2,(H,18,21)(H2,23,24,25) |
InChIKey | WZMQMKNCWDCCMT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O[P](O)(=O)CN1C(=O)C(=O)Nc2cc(c(cc12)N3CCOCC3)C(F)(F)F | OpenEye OEToolkits 1.7.0 | c1c(c(cc2c1NC(=O)C(=O)N2CP(=O)(O)O)N3CCOCC3)C(F)(F)F |
|
Formula | C14 H15 F3 N3 O6 P |
Name | {[7-morpholin-4-yl-2,3-dioxo-6-(trifluoromethyl)-3,4-dihydroquinoxalin-1(2H)-yl]methyl}phosphonic acid; [[3,4-Dihydro-7-(4-morpholinyl)-2,3-dioxo-6-(trifluorom ethyl)-1(2H)-quinoxalinyl]methyl]phosphonic acid |
ChEMBL | CHEMBL19892 |
DrugBank | DB12393 |
ZINC | ZINC000002004553
|
PDB chain | 6ucb Chain D Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|