Structure of PDB 6tzf Chain D Binding Site BS01 |
|
|
Ligand ID | KAS |
InChI | InChI=1S/C10H11BN3O7P/c15-10(16)8-3-1-2-7(4-8)9-5-14(13-12-9)6-11(17)21-22(18,19)20/h1-5,17H,6H2,(H,15,16)(H2,18,19,20) |
InChIKey | HJSPORKXLABRNX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC(c1cccc(c1)c2cn(CB(OP(=O)(O)O)O)nn2)=O | OpenEye OEToolkits 2.0.7 | B(Cn1cc(nn1)c2cccc(c2)C(=O)O)(O)OP(=O)(O)O | CACTVS 3.385 | OB(Cn1cc(nn1)c2cccc(c2)C(O)=O)O[P](O)(O)=O |
|
Formula | C10 H11 B N3 O7 P |
Name | 3-(1-{[hydroxy(phosphonooxy)boranyl]methyl}-1H-1,2,3-triazol-4-yl)benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6tzf Chain D Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|