Structure of PDB 6p5p Chain D Binding Site BS01 |
|
|
Ligand ID | O1V |
InChI | InChI=1S/C17H19N5OS/c1-9-11(8-18-21-9)14-7-12-15(24-14)17(23)20-16(19-12)13-6-10-2-4-22(13)5-3-10/h7-8,10,13H,2-6H2,1H3,(H,18,21)(H,19,20,23)/t13-/m0/s1 |
InChIKey | XGVXKJKTISMIOW-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1c(cn[nH]1)c2cc3c(s2)C(=O)NC(=N3)[C@@H]4CC5CCN4CC5 | CACTVS 3.385 | Cc1[nH]ncc1c2sc3C(=O)NC(=Nc3c2)[C@@H]4CC5CCN4CC5 | OpenEye OEToolkits 2.0.7 | Cc1c(cn[nH]1)c2cc3c(s2)C(=O)NC(=N3)C4CC5CCN4CC5 | CACTVS 3.385 | Cc1[nH]ncc1c2sc3C(=O)NC(=Nc3c2)[CH]4CC5CCN4CC5 | ACDLabs 12.01 | n1c(c(cn1)c2sc3c(c2)N=C(NC3=O)C5CC4CCN5CC4)C |
|
Formula | C17 H19 N5 O S |
Name | 2-[(2S)-1-azabicyclo[2.2.2]octan-2-yl]-6-(5-methyl-1H-pyrazol-4-yl)thieno[3,2-d]pyrimidin-4(3H)-one |
ChEMBL | CHEMBL4297644 |
DrugBank | DB16330 |
ZINC |
|
PDB chain | 6p5p Chain D Residue 2500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|