Structure of PDB 6mom Chain D Binding Site BS01 |
|
|
Ligand ID | JX4 |
InChI | InChI=1S/C21H23N7O/c1-27-12-14(9-24-27)16-13-28-18(11-23-21(28)8-19(16)29-2)17-4-3-5-20(26-17)25-15-6-7-22-10-15/h3-5,8-9,11-13,15,22H,6-7,10H2,1-2H3,(H,25,26)/t15-/m1/s1 |
InChIKey | IALDYVNFZAPNJV-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cn1cc(cn1)c2cn3c(cc2OC)ncc3c4cccc(n4)NC5CCNC5 | OpenEye OEToolkits 2.0.6 | Cn1cc(cn1)c2cn3c(cc2OC)ncc3c4cccc(n4)N[C@@H]5CCNC5 | ACDLabs 12.01 | c1c(c(OC)cc2ncc(n12)c3nc(ccc3)NC4CNCC4)c5cn(C)nc5 | CACTVS 3.385 | COc1cc2ncc(n2cc1c3cnn(C)c3)c4cccc(N[CH]5CCNC5)n4 | CACTVS 3.385 | COc1cc2ncc(n2cc1c3cnn(C)c3)c4cccc(N[C@@H]5CCNC5)n4 |
|
Formula | C21 H23 N7 O |
Name | 6-[7-methoxy-6-(1-methyl-1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-[(3R)-pyrrolidin-3-yl]pyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6mom Chain D Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|