Structure of PDB 6k9m Chain D Binding Site BS01 |
|
|
Ligand ID | D43 |
InChI | InChI=1S/C19H26N2O3/c1-12(2)15-19(10-11-21(15)17(23)24-18(3,4)5)13-8-6-7-9-14(13)20-16(19)22/h6-9,12,15H,10-11H2,1-5H3,(H,20,22)/t15-,19-/m0/s1 |
InChIKey | PENVAQPGQMBKCU-KXBFYZLASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)C1C2(CCN1C(=O)OC(C)(C)C)c3ccccc3NC2=O | OpenEye OEToolkits 2.0.7 | CC(C)[C@H]1[C@]2(CCN1C(=O)OC(C)(C)C)c3ccccc3NC2=O | CACTVS 3.385 | CC(C)[CH]1N(CC[C]12C(=O)Nc3ccccc23)C(=O)OC(C)(C)C | CACTVS 3.385 | CC(C)[C@@H]1N(CC[C@@]12C(=O)Nc3ccccc23)C(=O)OC(C)(C)C |
|
Formula | C19 H26 N2 O3 |
Name | ~{tert}-butyl (2'~{S},3~{S})-2-oxidanylidene-2'-propan-2-yl-spiro[1~{H}-indole-3,3'-pyrrolidine]-1'-carboxylate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6k9m Chain D Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|