Structure of PDB 6fkj Chain D Binding Site BS01 |
|
|
Ligand ID | DLW |
InChI | InChI=1S/C22H23NO3/c1-3-26-21-12-8-7-11-18(21)23-15(2)22-19(24)13-17(14-20(22)25)16-9-5-4-6-10-16/h4-12,17,24H,3,13-14H2,1-2H3/b23-15+/t17-/m0/s1 |
InChIKey | SXTKBCIYVZKDSS-BDFKGGEMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOc1ccccc1N=C(C)C2=C(O)C[CH](CC2=O)c3ccccc3 | OpenEye OEToolkits 2.0.6 | CCOc1ccccc1N=C(C)C2=C(CC(CC2=O)c3ccccc3)O | CACTVS 3.385 | CCOc1ccccc1N=C(C)C2=C(O)C[C@@H](CC2=O)c3ccccc3 | OpenEye OEToolkits 2.0.6 | CCOc1ccccc1/N=C(\C)/C2=C(C[C@@H](CC2=O)c3ccccc3)O |
|
Formula | C22 H23 N O3 |
Name | (5~{S})-2-[(~{E})-~{N}-(2-ethoxyphenyl)-~{C}-methyl-carbonimidoyl]-3-oxidanyl-5-phenyl-cyclohex-2-en-1-one; KNI-10075 |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6fkj Chain D Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|