Structure of PDB 6e7v Chain D Binding Site BS01 |
|
|
Ligand ID | T88 |
InChI | InChI=1S/C22H30Cl2N2O4S/c1-3-4-12-26(13-11-17-5-10-21(23)22(24)14-17)15-19(27)16-30-20-8-6-18(7-9-20)25-31(2,28)29/h5-10,14,19,25,27H,3-4,11-13,15-16H2,1-2H3/t19-/m1/s1 |
InChIKey | NHYMWKHINJIWJL-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCCN(CCc1ccc(c(c1)Cl)Cl)C[C@H](COc2ccc(cc2)NS(=O)(=O)C)O | ACDLabs 12.01 | c1(c(Cl)ccc(c1)CCN(CC(COc2ccc(cc2)NS(=O)(C)=O)O)CCCC)Cl | OpenEye OEToolkits 2.0.6 | CCCCN(CCc1ccc(c(c1)Cl)Cl)CC(COc2ccc(cc2)NS(=O)(=O)C)O | CACTVS 3.385 | CCCCN(CCc1ccc(Cl)c(Cl)c1)C[C@@H](O)COc2ccc(N[S](C)(=O)=O)cc2 | CACTVS 3.385 | CCCCN(CCc1ccc(Cl)c(Cl)c1)C[CH](O)COc2ccc(N[S](C)(=O)=O)cc2 |
|
Formula | C22 H30 Cl2 N2 O4 S |
Name | N-{4-[(2R)-3-{butyl[2-(3,4-dichlorophenyl)ethyl]amino}-2-hydroxypropoxy]phenyl}methanesulfonamide |
ChEMBL | CHEMBL521808 |
DrugBank | |
ZINC | ZINC000038383143
|
PDB chain | 6e7v Chain D Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|