Structure of PDB 6ayi Chain D Binding Site BS01 |
|
|
Ligand ID | C3G |
InChI | InChI=1S/C12H13NO9/c14-7-8(15)10(11(17)18)22-12(9(7)16)21-6-3-1-5(2-4-6)13(19)20/h1-4,7-10,12,14-16H,(H,17,18)/t7-,8-,9+,10-,12+/m0/s1 |
InChIKey | QSUILVWOWLUOEU-GOVZDWNOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(ccc1[N+](=O)[O-])OC2C(C(C(C(O2)C(=O)O)O)O)O | CACTVS 3.385 | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(O)=O)Oc2ccc(cc2)[N+]([O-])=O | OpenEye OEToolkits 2.0.6 | c1cc(ccc1[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O | CACTVS 3.385 | O[CH]1[CH](O)[CH](O[CH]([CH]1O)C(O)=O)Oc2ccc(cc2)[N+]([O-])=O | ACDLabs 12.01 | C(=O)(O)C1C(C(C(C(O1)Oc2ccc([N+](=O)[O-])cc2)O)O)O |
|
Formula | C12 H13 N O9 |
Name | 4-nitrophenyl beta-D-glucopyranosiduronic acid; 4-nitrophenyl beta-D-glucosiduronic acid; 4-nitrophenyl D-glucosiduronic acid; 4-nitrophenyl glucosiduronic acid |
ChEMBL | CHEMBL495244 |
DrugBank | |
ZINC | ZINC000004027679
|
PDB chain | 6ayi Chain D Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|