Structure of PDB 5wag Chain D Binding Site BS01 |
|
|
Ligand ID | A0V |
InChI | InChI=1S/C4H7BN3O7P/c9-4(10)3-1-8(7-6-3)2-5(11)15-16(12,13)14/h1,11H,2H2,(H,9,10)(H2,12,13,14) |
InChIKey | AEBNZGMSDDIREX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OB(Cn1cc(nn1)C(O)=O)O[P](O)(O)=O | ACDLabs 12.01 | C(B(OP(O)(O)=O)O)n1nnc(c1)C(O)=O | OpenEye OEToolkits 2.0.6 | B(Cn1cc(nn1)C(=O)O)(O)OP(=O)(O)O |
|
Formula | C4 H7 B N3 O7 P |
Name | 1-{[hydroxy(phosphonooxy)boranyl]methyl}-1H-1,2,3-triazole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wag Chain D Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|