Structure of PDB 5uvf Chain D Binding Site BS01 |
|
|
Ligand ID | 7DZ |
InChI | InChI=1S/C19H23F2N5O2/c1-10(2)5-6-26-11(3)18(28)25(4)15-9-22-19(24-17(15)26)23-12-7-13(20)16(27)14(21)8-12/h7-11,27H,5-6H2,1-4H3,(H,22,23,24)/t11-/m0/s1 |
InChIKey | DTEKTGDVSARYDS-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)CCN1[CH](C)C(=O)N(C)c2cnc(Nc3cc(F)c(O)c(F)c3)nc12 | CACTVS 3.385 | CC(C)CCN1[C@@H](C)C(=O)N(C)c2cnc(Nc3cc(F)c(O)c(F)c3)nc12 | ACDLabs 12.01 | CN3c1c(nc(nc1)Nc2cc(c(c(c2)F)O)F)N(CCC(C)C)C(C3=O)C | OpenEye OEToolkits 2.0.6 | C[C@H]1C(=O)N(c2cnc(nc2N1CCC(C)C)Nc3cc(c(c(c3)F)O)F)C | OpenEye OEToolkits 2.0.6 | CC1C(=O)N(c2cnc(nc2N1CCC(C)C)Nc3cc(c(c(c3)F)O)F)C |
|
Formula | C19 H23 F2 N5 O2 |
Name | (7S)-2-[(3,5-difluoro-4-hydroxyphenyl)amino]-5,7-dimethyl-8-(3-methylbutyl)-7,8-dihydropteridin-6(5H)-one; BI-D1870 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033359422
|
PDB chain | 5uvf Chain D Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|