Structure of PDB 5uis Chain D Binding Site BS01 |
|
|
Ligand ID | 8C1 |
InChI | InChI=1S/C18H23N3O3/c1-11(2)23-17-9-13-15(8-14(17)18(19)22)21-7-5-16(13)24-12-4-3-6-20-10-12/h5,7-9,11-12,20H,3-4,6,10H2,1-2H3,(H2,19,22)/t12-/m1/s1 |
InChIKey | WFDCRJQKOODGGI-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)Oc1cc2c(O[CH]3CCCNC3)ccnc2cc1C(N)=O | CACTVS 3.385 | CC(C)Oc1cc2c(O[C@@H]3CCCNC3)ccnc2cc1C(N)=O | OpenEye OEToolkits 2.0.6 | CC(C)Oc1cc2c(ccnc2cc1C(=O)N)O[C@@H]3CCCNC3 | OpenEye OEToolkits 2.0.6 | CC(C)Oc1cc2c(ccnc2cc1C(=O)N)OC3CCCNC3 | ACDLabs 12.01 | c21cc(OC(C)C)c(cc1nccc2OC3CCCNC3)C(N)=O |
|
Formula | C18 H23 N3 O3 |
Name | 4-{[(3R)-piperidin-3-yl]oxy}-6-[(propan-2-yl)oxy]quinoline-7-carboxamide |
ChEMBL | CHEMBL4061493 |
DrugBank | |
ZINC |
|
PDB chain | 5uis Chain D Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|