Structure of PDB 5tza Chain D Binding Site BS01 |
|
|
Ligand ID | 7OG |
InChI | InChI=1S/C22H21N5O/c1-15-11-20(27-22(25-15)23-14-24-27)19-7-4-10-26(13-19)21(28)18-9-8-16-5-2-3-6-17(16)12-18/h2-3,5-6,8-9,11-12,14,19H,4,7,10,13H2,1H3/t19-/m0/s1 |
InChIKey | TXIOKRWXRUIBEA-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc([CH]2CCCN(C2)C(=O)c3ccc4ccccc4c3)n5ncnc5n1 | OpenEye OEToolkits 2.0.6 | Cc1cc(n2c(n1)ncn2)[C@H]3CCCN(C3)C(=O)c4ccc5ccccc5c4 | OpenEye OEToolkits 2.0.6 | Cc1cc(n2c(n1)ncn2)C3CCCN(C3)C(=O)c4ccc5ccccc5c4 | CACTVS 3.385 | Cc1cc([C@H]2CCCN(C2)C(=O)c3ccc4ccccc4c3)n5ncnc5n1 | ACDLabs 12.01 | c51ncnn1c(C4CN(C(c3ccc2c(cccc2)c3)=O)CCC4)cc(C)n5 |
|
Formula | C22 H21 N5 O |
Name | [(3S)-3-(5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl](naphthalen-2-yl)methanone |
ChEMBL | CHEMBL4076035 |
DrugBank | |
ZINC | ZINC000584905442
|
PDB chain | 5tza Chain D Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|