Structure of PDB 5lxb Chain D Binding Site BS01 |
|
|
Ligand ID | 7A9 |
InChI | InChI=1S/C19H24N2O/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20/h2,4,6,13,15,17H,1,3,5,7-12H2/t15-,17+/m0/s1 |
InChIKey | CPZBLNMUGSZIPR-DOTOQJQBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1N(C[CH]2CCCc3cccc1c23)[CH]4CN5CCC4CC5 | CACTVS 3.385 | O=C1N(C[C@@H]2CCCc3cccc1c23)[C@@H]4CN5CCC4CC5 | OpenEye OEToolkits 2.0.5 | c1cc2c3c(c1)C(=O)N(C[C@@H]3CCC2)[C@@H]4CN5CCC4CC5 | OpenEye OEToolkits 2.0.5 | c1cc2c3c(c1)C(=O)N(CC3CCC2)C4CN5CCC4CC5 |
|
Formula | C19 H24 N2 O |
Name | palonosetron |
ChEMBL | CHEMBL1276421 |
DrugBank | |
ZINC | ZINC000006094354
|
PDB chain | 5lxb Chain C Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|