Structure of PDB 5kx8 Chain D Binding Site BS01 |
|
|
Ligand ID | 6YE |
InChI | InChI=1S/C16H19N9O2/c1-23-9-11(13(22-23)14(17)26)20-16(27)10-8-19-25-5-2-12(21-15(10)25)24-6-3-18-4-7-24/h2,5,8-9,18H,3-4,6-7H2,1H3,(H2,17,26)(H,20,27) |
InChIKey | LIUCOMBTIJNNMB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1cc(NC(=O)c2cnn3ccc(nc23)N4CCNCC4)c(n1)C(N)=O | OpenEye OEToolkits 2.0.5 | Cn1cc(c(n1)C(=O)N)NC(=O)c2cnn3c2nc(cc3)N4CCNCC4 |
|
Formula | C16 H19 N9 O2 |
Name | ~{N}-(3-aminocarbonyl-1-methyl-pyrazol-4-yl)-5-piperazin-1-yl-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
ChEMBL | CHEMBL4459066 |
DrugBank | |
ZINC | ZINC000584905084
|
PDB chain | 5kx8 Chain D Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|