Structure of PDB 5aiv Chain D Binding Site BS01 |
|
|
Ligand ID | M1W |
InChI | InChI=1S/C15H16N4O3/c1-21-9-3-7-17-14(20)15-18-13(19-22-15)11-4-2-5-12-10(11)6-8-16-12/h2,4-6,8,16H,3,7,9H2,1H3,(H,17,20) |
InChIKey | BPSPJIVDNLKGAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COCCCNC(=O)c1nc(no1)c2cccc3c2cc[nH]3 | CACTVS 3.385 | COCCCNC(=O)c1onc(n1)c2cccc3[nH]ccc23 | ACDLabs 12.01 | O=C(c1nc(no1)c3c2ccnc2ccc3)NCCCOC |
|
Formula | C15 H16 N4 O3 |
Name | 3-(1H-indol-4-yl)-N-(3-methoxypropyl)-1,2,4-oxadiazole-5-carboxamide |
ChEMBL | CHEMBL3425952 |
DrugBank | |
ZINC | ZINC000012391841
|
PDB chain | 5aiv Chain D Residue 1200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|