Structure of PDB 4zjj Chain D Binding Site BS01 |
|
|
Ligand ID | 4OR |
InChI | InChI=1S/C24H29ClFN5O/c1-5-31-20-8-6-15(25)12-18(20)22(28-19-13-16(26)7-9-21(19)31)27-17-10-11-30(14-17)23(32)29-24(2,3)4/h6-9,12-13,17H,5,10-11,14H2,1-4H3,(H,27,28)(H,29,32)/t17-/m0/s1 |
InChIKey | NIVBGOGCJSMNMG-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCN1c2ccc(cc2C(=Nc3c1ccc(c3)F)N[C@H]4CCN(C4)C(=O)NC(C)(C)C)Cl | ACDLabs 12.01 | C(C)N3c1ccc(cc1N=C(c2c3ccc(c2)Cl)NC4CN(CC4)C(=O)NC(C)(C)C)F | OpenEye OEToolkits 1.9.2 | CCN1c2ccc(cc2C(=Nc3c1ccc(c3)F)NC4CCN(C4)C(=O)NC(C)(C)C)Cl | CACTVS 3.385 | CCN1c2ccc(F)cc2N=C(N[CH]3CCN(C3)C(=O)NC(C)(C)C)c4cc(Cl)ccc14 | CACTVS 3.385 | CCN1c2ccc(F)cc2N=C(N[C@H]3CCN(C3)C(=O)NC(C)(C)C)c4cc(Cl)ccc14 |
|
Formula | C24 H29 Cl F N5 O |
Name | (S)-N-(tert-butyl)-3-((2-chloro-5-ethyl-8-fluoro-dibenzodiazepin-11-yl)amino)pyrrolidine-1-carboxamide |
ChEMBL | CHEMBL3609371 |
DrugBank | |
ZINC | ZINC000263620793
|
PDB chain | 4zjj Chain D Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|