Structure of PDB 4yb4 Chain D Binding Site BS01 |
|
|
Ligand ID | 48Y |
InChI | InChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3-,5+/m0/s1 |
InChIKey | OEJZZCGRGVFWHK-WVZVXSGGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[CH]([CH](CCC(O)=O)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(CCC(=O)O)C(O)C(=O)O | OpenEye OEToolkits 1.9.2 | C(CC(=O)O)C(C(C(=O)O)O)C(=O)O | OpenEye OEToolkits 1.9.2 | C(CC(=O)O)[C@@H]([C@H](C(=O)O)O)C(=O)O | CACTVS 3.385 | O[C@H]([C@H](CCC(O)=O)C(O)=O)C(O)=O |
|
Formula | C7 H10 O7 |
Name | (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid |
ChEMBL | CHEMBL375897 |
DrugBank | |
ZINC |
|
PDB chain | 4yb4 Chain C Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|