Structure of PDB 4qjz Chain D Binding Site BS01 |
|
|
Ligand ID | 33M |
InChI | InChI=1S/C18H16N6/c1-24(15-8-4-6-11-5-2-3-7-13(11)15)12-9-14-16(19)22-18(20)23-17(14)21-10-12/h2-10H,1H3,(H4,19,20,21,22,23) |
InChIKey | QNASXWBMQABDSW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(c1cnc2nc(N)nc(N)c2c1)c3cccc4ccccc34 | OpenEye OEToolkits 1.7.6 | CN(c1cccc2c1cccc2)c3cc4c(nc(nc4nc3)N)N | ACDLabs 12.01 | n1cc(cc2c1nc(nc2N)N)N(c4c3ccccc3ccc4)C |
|
Formula | C18 H16 N6 |
Name | N~6~-methyl-N~6~-(naphthalen-1-yl)pyrido[2,3-d]pyrimidine-2,4,6-triamine |
ChEMBL | CHEMBL2382334 |
DrugBank | |
ZINC | ZINC000096269959
|
PDB chain | 4qjz Chain D Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|