Structure of PDB 4qde Chain D Binding Site BS01 |
|
|
Ligand ID | 30S |
InChI | InChI=1S/C15H14N4O4S/c16-14-13-10(18-15(17)19-14)5-3-6-11(13)23-8-9-4-1-2-7-12(9)24(20,21)22/h1-7H,8H2,(H,20,21,22)(H4,16,17,18,19) |
InChIKey | RZCCCBZCJSAGMZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1nc(N)c2c(OCc3ccccc3[S](O)(=O)=O)cccc2n1 | ACDLabs 12.01 | O=S(=O)(O)c1ccccc1COc3c2c(nc(nc2N)N)ccc3 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)COc2cccc3c2c(nc(n3)N)N)S(=O)(=O)O |
|
Formula | C15 H14 N4 O4 S |
Name | 2-{[(2,4-diaminoquinazolin-5-yl)oxy]methyl}benzenesulfonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230470595
|
PDB chain | 4qde Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.1.59: 5'-(N(7)-methyl 5'-triphosphoguanosine)-[mRNA] diphosphatase. |
|
|
|