Structure of PDB 4ixh Chain D Binding Site BS01 |
|
|
Ligand ID | Q21 |
InChI | InChI=1S/C25H19N3O3/c1-16(30-22-8-4-6-17-5-2-3-7-20(17)22)24(29)27-19-9-10-23-21(15-19)28-25(31-23)18-11-13-26-14-12-18/h2-16H,1H3,(H,27,29)/t16-/m0/s1 |
InChIKey | QCNXGTHMVPSAAC-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1cc2nc(oc2cc1)c3ccncc3)C(Oc5c4ccccc4ccc5)C | OpenEye OEToolkits 1.7.6 | CC(C(=O)Nc1ccc2c(c1)nc(o2)c3ccncc3)Oc4cccc5c4cccc5 | CACTVS 3.370 | C[CH](Oc1cccc2ccccc12)C(=O)Nc3ccc4oc(nc4c3)c5ccncc5 | OpenEye OEToolkits 1.7.6 | C[C@@H](C(=O)Nc1ccc2c(c1)nc(o2)c3ccncc3)Oc4cccc5c4cccc5 | CACTVS 3.370 | C[C@H](Oc1cccc2ccccc12)C(=O)Nc3ccc4oc(nc4c3)c5ccncc5 |
|
Formula | C25 H19 N3 O3 |
Name | (2S)-2-(naphthalen-1-yloxy)-N-[2-(pyridin-4-yl)-1,3-benzoxazol-5-yl]propanamide |
ChEMBL | CHEMBL2348823 |
DrugBank | |
ZINC | ZINC000095601520
|
PDB chain | 4ixh Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.205: IMP dehydrogenase. |
|
|
|