Structure of PDB 4ixe Chain D Binding Site BS01 |
|
|
Ligand ID | IXE |
InChI | InChI=1S/C14H11F3N6/c1-23(6-3-9(15)11(17)10(16)4-6)7-2-8-12(18)21-14(19)22-13(8)20-5-7/h2-5H,1H3,(H4,18,19,20,21,22) |
InChIKey | RYXUPKGYPPPMSC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1cc(cc(F)c1F)N(c2cc3c(nc2)nc(nc3N)N)C | OpenEye OEToolkits 1.7.6 | CN(c1cc(c(c(c1)F)F)F)c2cc3c(nc(nc3nc2)N)N | CACTVS 3.370 | CN(c1cnc2nc(N)nc(N)c2c1)c3cc(F)c(F)c(F)c3 |
|
Formula | C14 H11 F3 N6 |
Name | N~6~-methyl-N~6~-(3,4,5-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4,6-triamine |
ChEMBL | CHEMBL2382336 |
DrugBank | |
ZINC | ZINC000095921390
|
PDB chain | 4ixe Chain D Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|