Structure of PDB 4i9n Chain D Binding Site BS01 |
|
|
Ligand ID | 1E6 |
InChI | InChI=1S/C18H19ClN2O7S/c1-27-15-5-14(28-8-11(23)7-22)12(19)4-13(15)21-16(24)9-29-17-3-2-10(6-20-17)18(25)26/h2-6,11,22-23H,7-9H2,1H3,(H,21,24)(H,25,26)/t11-/m0/s1 |
InChIKey | JUOFKXYNMCCWAA-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cc(c(cc1NC(=O)CSc2ccc(cn2)C(=O)O)Cl)OCC(CO)O | CACTVS 3.370 | COc1cc(OC[C@@H](O)CO)c(Cl)cc1NC(=O)CSc2ccc(cn2)C(O)=O | ACDLabs 12.01 | Clc1cc(c(OC)cc1OCC(O)CO)NC(=O)CSc2ncc(cc2)C(=O)O | CACTVS 3.370 | COc1cc(OC[CH](O)CO)c(Cl)cc1NC(=O)CSc2ccc(cn2)C(O)=O | OpenEye OEToolkits 1.7.6 | COc1cc(c(cc1NC(=O)CSc2ccc(cn2)C(=O)O)Cl)OC[C@H](CO)O |
|
Formula | C18 H19 Cl N2 O7 S |
Name | 6-({2-[(5-chloro-4-{[(2S)-2,3-dihydroxypropyl]oxy}-2-methoxyphenyl)amino]-2-oxoethyl}sulfanyl)pyridine-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095597032
|
PDB chain | 4i9n Chain D Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|