Structure of PDB 4ewn Chain D Binding Site BS01 |
|
|
Ligand ID | 0VR |
InChI | InChI=1S/C12H18NO9P/c14-9(11(16)10(15)6-22-23(19,20)21)5-13-8-4-2-1-3-7(8)12(17)18/h1-4,9-11,13-16H,5-6H2,(H,17,18)(H2,19,20,21)/t9-,10+,11-/m0/s1 |
InChIKey | AULMJMUNCOBRHC-AXFHLTTASA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(O)(O)OCC(O)C(O)C(O)CNc1ccccc1C(=O)O | CACTVS 3.370 | O[CH](CNc1ccccc1C(O)=O)[CH](O)[CH](O)CO[P](O)(O)=O | CACTVS 3.370 | O[C@@H](CNc1ccccc1C(O)=O)[C@H](O)[C@H](O)CO[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)C(=O)O)NCC(C(C(COP(=O)(O)O)O)O)O | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)C(=O)O)NC[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O |
|
Formula | C12 H18 N O9 P |
Name | 1-(O-carboxy-phenylamino)-1-deoxy-D-ribulose-5-phosphate; 1-[(2-carboxyphenyl)amino]-1-deoxy-5-O-phosphono-D-ribitol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002047809
|
PDB chain | 4ewn Chain D Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.3.2.10: imidazole glycerol-phosphate synthase. |
|
|
|