Structure of PDB 4bbf Chain D Binding Site BS01 |
|
|
Ligand ID | O19 |
InChI | InChI=1S/C25H28N6O2/c32-24(23-2-1-12-26-23)28-19-5-3-18(4-6-19)22-11-13-27-25(30-22)29-20-7-9-21(10-8-20)31-14-16-33-17-15-31/h3-11,13,23,26H,1-2,12,14-17H2,(H,28,32)(H,27,29,30)/t23-/m1/s1 |
InChIKey | ISOCDPQFIXDIMS-HSZRJFAPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(Nc1ccc(cc1)c2ccnc(Nc3ccc(cc3)N4CCOCC4)n2)[CH]5CCCN5 | CACTVS 3.385 | O=C(Nc1ccc(cc1)c2ccnc(Nc3ccc(cc3)N4CCOCC4)n2)[C@H]5CCCN5 | ACDLabs 12.01 | O=C(Nc1ccc(cc1)c2nc(ncc2)Nc4ccc(N3CCOCC3)cc4)C5NCCC5 | OpenEye OEToolkits 1.9.2 | c1cc(ccc1c2ccnc(n2)Nc3ccc(cc3)N4CCOCC4)NC(=O)C5CCCN5 | OpenEye OEToolkits 1.9.2 | c1cc(ccc1c2ccnc(n2)Nc3ccc(cc3)N4CCOCC4)NC(=O)[C@H]5CCCN5 |
|
Formula | C25 H28 N6 O2 |
Name | (2R)-N-[4-[2-[(4-morpholin-4-ylphenyl)amino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL2208034 |
DrugBank | |
ZINC | ZINC000095560529
|
PDB chain | 4bbf Chain D Residue 2229
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|