Structure of PDB 3hpt Chain D Binding Site BS01 |
|
|
Ligand ID | YET |
InChI | InChI=1S/C23H28N6O3/c1-16-12-17-13-18(7-8-20(17)32-16)26-23(25-15-24)27-19-6-2-3-11-29(22(19)31)14-21(30)28-9-4-5-10-28/h7-8,12-13,19H,2-6,9-11,14H2,1H3,(H2,25,26,27)/t19-/m0/s1 |
InChIKey | BQUXAJWDRCSKFN-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C2N(CC(=O)N1CCCC1)CCCCC2NC(=N\c4cc3c(oc(c3)C)cc4)/NC#N | CACTVS 3.341 | Cc1oc2ccc(cc2c1)N=C(NC#N)N[C@H]3CCCCN(CC(=O)N4CCCC4)C3=O | OpenEye OEToolkits 1.5.0 | Cc1cc2cc(ccc2o1)/N=C(/NC#N)\N[C@H]3CCCCN(C3=O)CC(=O)N4CCCC4 | OpenEye OEToolkits 1.5.0 | Cc1cc2cc(ccc2o1)N=C(NC#N)NC3CCCCN(C3=O)CC(=O)N4CCCC4 | CACTVS 3.341 | Cc1oc2ccc(cc2c1)N=C(NC#N)N[CH]3CCCCN(CC(=O)N4CCCC4)C3=O |
|
Formula | C23 H28 N6 O3 |
Name | 1-cyano-2-(2-methyl-1-benzofuran-5-yl)-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
ChEMBL | CHEMBL551991 |
DrugBank | |
ZINC | ZINC000043019712
|
PDB chain | 3hpt Chain D Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|