Structure of PDB 3g42 Chain D Binding Site BS01 |
|
|
Ligand ID | 792 |
InChI | InChI=1S/C22H22N2O5S/c1-3-4-11-29-17-6-8-18(9-7-17)30(27,28)24-21(22(25)26)13-16-14-23-20-10-5-15(2)12-19(16)20/h5-10,12,14,21,23-24H,11,13H2,1-2H3,(H,25,26)/t21-/m1/s1 |
InChIKey | SFVPXERGVLDWIS-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC#CCOc1ccc(cc1)[S](=O)(=O)N[C@H](Cc2c[nH]c3ccc(C)cc23)C(O)=O | CACTVS 3.341 | CC#CCOc1ccc(cc1)[S](=O)(=O)N[CH](Cc2c[nH]c3ccc(C)cc23)C(O)=O | ACDLabs 10.04 | O=S(=O)(c1ccc(OCC#CC)cc1)NC(C(=O)O)Cc3c2cc(ccc2nc3)C | OpenEye OEToolkits 1.5.0 | CC#CCOc1ccc(cc1)S(=O)(=O)N[C@H](Cc2c[nH]c3c2cc(cc3)C)C(=O)O | OpenEye OEToolkits 1.5.0 | CC#CCOc1ccc(cc1)S(=O)(=O)NC(Cc2c[nH]c3c2cc(cc3)C)C(=O)O |
|
Formula | C22 H22 N2 O5 S |
Name | N-{[4-(but-2-yn-1-yloxy)phenyl]sulfonyl}-5-methyl-D-tryptophan |
ChEMBL | CHEMBL527018 |
DrugBank | DB07233 |
ZINC | ZINC000038225899
|
PDB chain | 3g42 Chain D Residue 4
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.24.86: ADAM 17 endopeptidase. |
|
|
|