Structure of PDB 2flh Chain D Binding Site BS01 |
|
|
Ligand ID | ZEA |
InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
InChIKey | UZKQTCBAMSWPJD-FARCUNLSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | CC(=CCNc1c2c([nH]cn2)ncn1)CO | OpenEye OEToolkits 1.7.5 | C/C(=C\CNc1c2c([nH]cn2)ncn1)/CO | CACTVS 3.385 | CC(/CO)=C\CNc1ncnc2[nH]cnc12 | CACTVS 3.385 | CC(CO)=CCNc1ncnc2[nH]cnc12 | ACDLabs 10.04 | n2c1c(ncn1)c(nc2)NC\C=C(/C)CO |
|
Formula | C10 H13 N5 O |
Name | (2E)-2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol; TRANS-ZEATIN |
ChEMBL | CHEMBL525239 |
DrugBank | DB11337 |
ZINC | ZINC000004492895
|
PDB chain | 2flh Chain D Residue 706
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|