Structure of PDB 1nwg Chain D Binding Site BS01 |
|
|
Ligand ID | BGN |
InChI | InChI=1S/C10H19NO6/c1-2-3-6(13)11-7-9(15)8(14)5(4-12)17-10(7)16/h5,7-10,12,14-16H,2-4H2,1H3,(H,11,13)/t5-,7-,8-,9-,10-/m1/s1 |
InChIKey | RPJMPMDUKSRLLF-QXOHVQIXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCCC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O)O | OpenEye OEToolkits 1.5.0 | CCCC(=O)NC1C(C(C(OC1O)CO)O)O | CACTVS 3.341 | CCCC(=O)N[CH]1[CH](O)O[CH](CO)[CH](O)[CH]1O | ACDLabs 10.04 | O=C(NC1C(O)C(O)C(OC1O)CO)CCC | CACTVS 3.341 | CCCC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
|
Formula | C10 H19 N O6 |
Name | 2-(butanoylamino)-2-deoxy-beta-D-glucopyranose; N-BUTANOYL-2-AMINO-2-DEOXY-GLUCOPYRANOSIDE; N-BUTANOYL-GLUCOSAMINE; N-butanoyl-beta-D-glucosamine; 2-(butanoylamino)-2-deoxy-beta-D-glucose; 2-(butanoylamino)-2-deoxy-D-glucose; 2-(butanoylamino)-2-deoxy-glucose |
ChEMBL | CHEMBL1231320 |
DrugBank | |
ZINC | ZINC000005972854
|
PDB chain | 1nwg Chain D Residue 527
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|