Structure of PDB 8fsz Chain C Binding Site BS01 |
|
|
Ligand ID | Y7H |
InChI | InChI=1S/C18H22N4O/c23-18-14-2-1-3-15-17(14)16(20-19-15)6-9-22(18)13-10-12-4-7-21(11-13)8-5-12/h1-3,12-13H,4-11H2,(H,19,20)/t13-/m0/s1 |
InChIKey | IZPGDYACPJMETA-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)[nH]nc3CCN(C2=O)C4CC5CCN(C4)CC5 | OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)[nH]nc3CCN(C2=O)[C@H]4CC5CCN(C4)CC5 | CACTVS 3.385 | O=C1N(CCc2n[nH]c3cccc1c23)[C@H]4CC5CCN(CC5)C4 | CACTVS 3.385 | O=C1N(CCc2n[nH]c3cccc1c23)[CH]4CC5CCN(CC5)C4 | ACDLabs 12.01 | O=C1c2cccc3[NH]nc(CCN1C1CC4CCN(CC4)C1)c23 |
|
Formula | C18 H22 N4 O |
Name | 5-[(1R,3S,5R)-1-azabicyclo[3.2.2]nonan-3-yl]-1,3,4,5-tetrahydro-6H-azepino[5,4,3-cd]indazol-6-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8fsz Chain B Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|