Structure of PDB 8db9 Chain C Binding Site BS01 |
|
|
Ligand ID | R1Y |
InChI | InChI=1S/C8H13N5O4/c9-6(10)7-11-2-13(12-7)8-5(16)4(15)3(1-14)17-8/h2-5,8,14-16H,1H2,(H3,9,10)/t3-,4-,5-,8-/m1/s1 |
InChIKey | NHKZSTHOYNWEEZ-AFCXAGJDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | [H]/N=C(\c1ncn(n1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)/N | CACTVS 3.385 | NC(=N)c1ncn(n1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O | CACTVS 3.385 | NC(=N)c1ncn(n1)[CH]2O[CH](CO)[CH](O)[CH]2O | OpenEye OEToolkits 2.0.7 | c1nc(nn1C2C(C(C(O2)CO)O)O)C(=N)N | ACDLabs 12.01 | N=C(N)c1ncn(n1)C1OC(CO)C(O)C1O |
|
Formula | C8 H13 N5 O4 |
Name | 1-beta-D-ribofuranosyl-1H-1,2,4-triazole-3-carboximidamide |
ChEMBL | CHEMBL2111108 |
DrugBank | DB06408 |
ZINC | ZINC000003781686
|
PDB chain | 8db9 Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|