Structure of PDB 8cbv Chain C Binding Site BS01 |
|
|
Ligand ID | U5S |
InChI | InChI=1S/C25H27FO4/c1-13-5-10-18(15-6-7-15)22(21(13)24(25(27)28)30-16-8-9-16)19-12-20(26)23-17(14(19)2)4-3-11-29-23/h5,10,12,15-16,24H,3-4,6-9,11H2,1-2H3,(H,27,28)/t24-/m0/s1 |
InChIKey | TZYJXTQEMZMKAV-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(C2CC2)c(c3cc(F)c4OCCCc4c3C)c1[C@H](OC5CC5)C(O)=O | OpenEye OEToolkits 2.0.7 | Cc1ccc(c(c1C(C(=O)O)OC2CC2)c3cc(c4c(c3C)CCCO4)F)C5CC5 | CACTVS 3.385 | Cc1ccc(C2CC2)c(c3cc(F)c4OCCCc4c3C)c1[CH](OC5CC5)C(O)=O | OpenEye OEToolkits 2.0.7 | Cc1ccc(c(c1[C@@H](C(=O)O)OC2CC2)c3cc(c4c(c3C)CCCO4)F)C5CC5 |
|
Formula | C25 H27 F O4 |
Name | (2~{S})-2-[3-cyclopropyl-2-(8-fluoranyl-5-methyl-3,4-dihydro-2~{H}-chromen-6-yl)-6-methyl-phenyl]-2-cyclopropyloxy-ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8cbv Chain D Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|