Structure of PDB 8a1q Chain C Binding Site BS01 |
|
|
|
| Ligand ID | WBV |
| InChI | InChI=1S/C27H31ClN4O3/c1-15-17(3)32(14-18-12-29-31(7)13-18)25-21(15)23(19-8-10-20(28)11-9-19)22(16(2)30-25)24(26(33)34)35-27(4,5)6/h8-13,24H,14H2,1-7H3,(H,33,34)/t24-/m0/s1 |
| InChIKey | GNRDGAWRAIJOSU-DEOSSOPVSA-N |
| SMILES | | Software | SMILES |
|---|
| ACDLabs 12.01 | Cc3nc4n(Cc1cnn(C)c1)c(C)c(C)c4c(c2ccc(cc2)Cl)c3C(C(O)=O)OC(C)(C)C | | OpenEye OEToolkits 2.0.7 | Cc1c(n(c2c1c(c(c(n2)C)[C@@H](C(=O)O)OC(C)(C)C)c3ccc(cc3)Cl)Cc4cnn(c4)C)C | | CACTVS 3.385 | Cn1cc(Cn2c(C)c(C)c3c2nc(C)c([CH](OC(C)(C)C)C(O)=O)c3c4ccc(Cl)cc4)cn1 | | CACTVS 3.385 | Cn1cc(Cn2c(C)c(C)c3c2nc(C)c([C@H](OC(C)(C)C)C(O)=O)c3c4ccc(Cl)cc4)cn1 | | OpenEye OEToolkits 2.0.7 | Cc1c(n(c2c1c(c(c(n2)C)C(C(=O)O)OC(C)(C)C)c3ccc(cc3)Cl)Cc4cnn(c4)C)C |
|
| Formula | C27 H31 Cl N4 O3 |
| Name | (2S)-tert-butoxy{4-(4-chlorophenyl)-2,3,6-trimethyl-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-5-yl}acetic acid;
Pirmitegravir |
| ChEMBL | CHEMBL5095077 |
| DrugBank | |
| ZINC |
|
| PDB chain | 8a1q Chain B Residue 308
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
