Structure of PDB 7y0f Chain C Binding Site BS01 |
|
|
Ligand ID | I9V |
InChI | InChI=1S/C14H16ClN5O4S/c1-14(2,12(21)22)20-25(23,24)7-3-4-8-9(5-7)11(19-13(16)17)18-6-10(8)15/h3-6,20H,1-2H3,(H,21,22)(H4,16,17,18,19) |
InChIKey | XSDAXWRCPTYNOD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | [H]/N=C(\N)/Nc1c2cc(ccc2c(cn1)Cl)S(=O)(=O)NC(C)(C)C(=O)O | CACTVS 3.385 | CC(C)(N[S](=O)(=O)c1ccc2c(Cl)cnc(NC(N)=N)c2c1)C(O)=O | OpenEye OEToolkits 2.0.7 | CC(C)(C(=O)O)NS(=O)(=O)c1ccc2c(c1)c(ncc2Cl)NC(=N)N |
|
Formula | C14 H16 Cl N5 O4 S |
Name | 2-[(1-carbamimidamido-4-chloranyl-isoquinolin-7-yl)sulfonylamino]-2-methyl-propanoic acid; UK-371804 |
ChEMBL | CHEMBL227421 |
DrugBank | |
ZINC | ZINC000014960788
|
PDB chain | 7y0f Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.122: transmembrane protease serine 2. |
|
|
|