Structure of PDB 7vva Chain C Binding Site BS01 |
|
|
Ligand ID | FJF |
InChI | InChI=1S/C9H12N2O6/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,16)/t4-,5-,6-,7+/m1/s1 |
InChIKey | PTJWIQPHWPFNBW-GBNDHIKLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH]1O[CH]([CH](O)[CH]1O)C2=CNC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | C1=C(C(=O)NC(=O)N1)C2C(C(C(O2)CO)O)O | OpenEye OEToolkits 2.0.7 | C1=C(C(=O)NC(=O)N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O | CACTVS 3.385 | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)C2=CNC(=O)NC2=O |
|
Formula | C9 H12 N2 O6 |
Name | 5-[(2~{S},3~{R},4~{S},5~{R})-5-(hydroxymethyl)-3,4-bis(oxidanyl)oxolan-2-yl]-1~{H}-pyrimidine-2,4-dione |
ChEMBL | CHEMBL3144027 |
DrugBank | |
ZINC | ZINC000004095788
|
PDB chain | 7vva Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.83: pseudouridine kinase. |
|
|
|