Structure of PDB 7cs6 Chain C Binding Site BS01 |
|
|
Ligand ID | GFR |
InChI | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m1/s1 |
InChIKey | MHXCIKYXNYCMHY-SXGZJXTBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)CC2COC(C2CO)c3ccc(c(c3)OC)O | CACTVS 3.385 | COc1cc(C[CH]2CO[CH]([CH]2CO)c3ccc(O)c(OC)c3)ccc1O | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)C[C@@H]2CO[C@H]([C@@H]2CO)c3ccc(c(c3)OC)O | CACTVS 3.385 | COc1cc(C[C@@H]2CO[C@H]([C@@H]2CO)c3ccc(O)c(OC)c3)ccc1O |
|
Formula | C20 H24 O6 |
Name | 4-[[(3S,4S,5R)-4-(hydroxymethyl)-5-(3-methoxy-4-oxidanyl-phenyl)oxolan-3-yl]methyl]-2-methoxy-phenol; (-)-Lariciresinol |
ChEMBL | CHEMBL487997 |
DrugBank | |
ZINC | ZINC000000900145
|
PDB chain | 7cs6 Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|