Structure of PDB 6w9u Chain C Binding Site BS01 |
|
|
Ligand ID | TKG |
InChI | InChI=1S/C10H9N5O3/c1-4(16)6-3-11-8-7(13-6)9(18)15-10(14-8)12-5(2)17/h3H,1-2H3,(H2,11,12,14,15,17,18) |
InChIKey | OMULKSTUKAPZMF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)NC1=Nc2ncc(nc2C(=O)N1)C(C)=O | OpenEye OEToolkits 2.0.7 | CC(=O)c1cnc2c(n1)C(=O)NC(=N2)NC(=O)C | ACDLabs 12.01 | C(C)(NC1=Nc2c(C(=O)N1)nc(cn2)C(C)=O)=O |
|
Formula | C10 H9 N5 O3 |
Name | 1-[[6-(1-$l^{1}-oxidanylethyl)-4-$l^{3}-oxidanylidene-2,3,6,8~{a}-tetrahydropteridin-2-yl]-$l^{2}-azanyl]ethanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6w9u Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|