Structure of PDB 6umf Chain C Binding Site BS01 |
|
|
Ligand ID | QAM |
InChI | InChI=1S/C17H19N7O2S2/c18-14-20-22-16(27-14)24-8-6-12(7-9-24)26-17-23-21-15(28-17)19-13(25)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,18,20)(H,19,21,25) |
InChIKey | KOUAUIYDHAPKFX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1sc(nn1)N2CCC(CC2)Oc3sc(NC(=O)Cc4ccccc4)nn3 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CC(=O)Nc2nnc(s2)OC3CCN(CC3)c4nnc(s4)N | ACDLabs 12.01 | N(c3sc(OC1CCN(CC1)c2sc(N)nn2)nn3)C(Cc4ccccc4)=O |
|
Formula | C17 H19 N7 O2 S2 |
Name | N-(5-{[1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-yl]oxy}-1,3,4-thiadiazol-2-yl)-2-phenylacetamide |
ChEMBL | CHEMBL3769551 |
DrugBank | |
ZINC | ZINC000653702271
|
PDB chain | 6umf Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|