Structure of PDB 6uap Chain C Binding Site BS01 |
|
|
Ligand ID | H9V |
InChI | InChI=1S/C17H12ClF3N2/c18-11-5-12(20)16(13(21)6-11)9-1-3-10(4-2-9)17-14(7-19)23-15(17)8-22/h1-6,14-15,17,23H,7H2/t14-,15-,17+/m0/s1 |
InChIKey | XHUZEPHBFHVYMY-YQQAZPJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC[CH]1N[CH](C#N)[CH]1c2ccc(cc2)c3c(F)cc(Cl)cc3F | OpenEye OEToolkits 2.0.6 | c1cc(ccc1c2c(cc(cc2F)Cl)F)C3C(NC3C#N)CF | OpenEye OEToolkits 2.0.6 | c1cc(ccc1c2c(cc(cc2F)Cl)F)[C@@H]3[C@@H](N[C@H]3C#N)CF | CACTVS 3.385 | FC[C@@H]1N[C@@H](C#N)[C@@H]1c2ccc(cc2)c3c(F)cc(Cl)cc3F | ACDLabs 12.01 | c1cc(ccc1C2C(CF)NC2C#N)c3c(cc(cc3F)Cl)F |
|
Formula | C17 H12 Cl F3 N2 |
Name | (2R,3S,4R)-3-(4'-chloro-2',6'-difluoro[1,1'-biphenyl]-4-yl)-4-(fluoromethyl)azetidine-2-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6uap Chain D Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E57 D68 Y181 |
Catalytic site (residue number reindexed from 1) |
E49 D60 Y173 |
Enzyme Commision number |
4.2.1.20: tryptophan synthase. |
|
|
|