Structure of PDB 6rt8 Chain C Binding Site BS01 |
|
|
Ligand ID | KJE |
InChI | InChI=1S/C21H25N2O2/c1-3-14-10-15-11-18(21(24)25-2)20-17(8-9-23(12-14)13-15)16-6-4-5-7-19(16)22-20/h4-7,10,12,15,17-18H,3,8-9,11,13H2,1-2H3/q+1/t15-,17+,18+/m0/s1 |
InChIKey | ULODILYUCKTWMV-CGTJXYLNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC1=C[C@H]2C[C@@H](C(=O)OC)C3=Nc4ccccc4[C@H]3CC[N@@+](=C1)C2 | OpenEye OEToolkits 2.0.7 | CCC1=CC2CC(C3=Nc4ccccc4C3CC[N+](=C1)C2)C(=O)OC | OpenEye OEToolkits 2.0.7 | CCC1=C[C@H]2C[C@H](C3=Nc4ccccc4C3CC[N+](=C1)C2)C(=O)OC | CACTVS 3.385 | CCC1=C[CH]2C[CH](C(=O)OC)C3=Nc4ccccc4[CH]3CC[N+](=C1)C2 |
|
Formula | C21 H25 N2 O2 |
Name | 18-carboxymethoxy-cleaviminium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6rt8 Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|