Structure of PDB 6pvc Chain C Binding Site BS01 |
|
|
Ligand ID | P1J |
InChI | InChI=1S/C8H9N3O5/c12-5-3-4(10-8(16)11-5)7(15)9-2-1-6(13)14/h3H,1-2H2,(H,9,15)(H,13,14)(H2,10,11,12,16) |
InChIKey | HLVBXSGXJVQJGW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CCNC(=O)C1=CC(=O)NC(=O)N1 | ACDLabs 12.01 | C(C(O)=O)CNC(C=1NC(=O)NC(C=1)=O)=O | OpenEye OEToolkits 2.0.7 | C1=C(NC(=O)NC1=O)C(=O)NCCC(=O)O |
|
Formula | C8 H9 N3 O5 |
Name | N-(2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carbonyl)-beta-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001087986
|
PDB chain | 6pvc Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|