Structure of PDB 6pet Chain C Binding Site BS01 |
|
|
Ligand ID | G9J |
InChI | InChI=1S/C22H17IO3/c1-13-19-12-18(25)9-10-20(19)26-22(14-5-7-16(23)8-6-14)21(13)15-3-2-4-17(24)11-15/h2-12,22,24-25H,1H3/t22-/m0/s1 |
InChIKey | RWKXMXMLZHFKIZ-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1=C([C@@H](Oc2ccc(O)cc12)c3ccc(I)cc3)c4cccc(O)c4 | ACDLabs 12.01 | CC=1c4c(OC(C=1c2cc(ccc2)O)c3ccc(cc3)I)ccc(c4)O | OpenEye OEToolkits 2.0.6 | CC1=C(C(Oc2c1cc(cc2)O)c3ccc(cc3)I)c4cccc(c4)O | CACTVS 3.385 | CC1=C([CH](Oc2ccc(O)cc12)c3ccc(I)cc3)c4cccc(O)c4 | OpenEye OEToolkits 2.0.6 | CC1=C([C@@H](Oc2c1cc(cc2)O)c3ccc(cc3)I)c4cccc(c4)O |
|
Formula | C22 H17 I O3 |
Name | (2S)-3-(3-hydroxyphenyl)-2-(4-iodophenyl)-4-methyl-2H-1-benzopyran-6-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pet Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|