Structure of PDB 6nwt Chain C Binding Site BS01 |
|
|
Ligand ID | L7P |
InChI | InChI=1S/C26H24F7N3O/c27-23-15-21(24(37,25(28,29)30)26(31,32)33)5-6-22(23)20-3-1-18(2-4-20)16-35-11-13-36(14-12-35)17-19-7-9-34-10-8-19/h1-10,15,37H,11-14,16-17H2 |
InChIKey | KVHKWAZUPPBMLL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C(O)(C(F)(F)F)(c4cc(F)c(c3ccc(CN1CCN(CC1)Cc2ccncc2)cc3)cc4)C(F)(F)F | CACTVS 3.385 | OC(c1ccc(c(F)c1)c2ccc(CN3CCN(CC3)Cc4ccncc4)cc2)(C(F)(F)F)C(F)(F)F | OpenEye OEToolkits 2.0.7 | c1cc(ccc1CN2CCN(CC2)Cc3ccncc3)c4ccc(cc4F)C(C(F)(F)F)(C(F)(F)F)O |
|
Formula | C26 H24 F7 N3 O |
Name | 1,1,1,3,3,3-hexafluoro-2-[2-fluoro-4'-({4-[(pyridin-4-yl)methyl]piperazin-1-yl}methyl)[1,1'-biphenyl]-4-yl]propan-2-ol |
ChEMBL | CHEMBL2137199 |
DrugBank | |
ZINC | ZINC000095571083
|
PDB chain | 6nwt Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|