Structure of PDB 6nlz Chain C Binding Site BS01 |
|
|
Ligand ID | KSJ |
InChI | InChI=1S/C14H16O4/c15-12-7-2-1-5-11(12)14(18)10-6-3-4-9(10)8-13(16)17/h1-2,5,7,9-10,15H,3-4,6,8H2,(H,16,17)/t9-,10+/m0/s1 |
InChIKey | LULBZYDRYZGRST-VHSXEESVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C[C@@H]1CCC[C@H]1C(=O)c2ccccc2O | ACDLabs 12.01 | C1(CCCC1CC(O)=O)C(c2ccccc2O)=O | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)C(=O)[C@@H]2CCC[C@H]2CC(=O)O)O | CACTVS 3.385 | OC(=O)C[CH]1CCC[CH]1C(=O)c2ccccc2O | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)C(=O)C2CCCC2CC(=O)O)O |
|
Formula | C14 H16 O4 |
Name | [(1S,2R)-2-(2-hydroxybenzene-1-carbonyl)cyclopentyl]acetic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6nlz Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|