Structure of PDB 6eej Chain C Binding Site BS01 |
|
|
Ligand ID | J6S |
InChI | InChI=1S/C12H9NO5/c14-11(12(15)16)4-2-1-3-9-5-7-10(8-6-9)13(17)18/h1-8H,(H,15,16)/b3-1+,4-2+ |
InChIKey | YFKMPGYOVOFESP-ZPUQHVIOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(ccc1C=CC=CC(=O)C(=O)O)[N+](=O)[O-] | OpenEye OEToolkits 2.0.6 | c1cc(ccc1/C=C/C=C/C(=O)C(=O)O)[N+](=O)[O-] | CACTVS 3.385 | OC(=O)C(=O)C=CC=Cc1ccc(cc1)[N+]([O-])=O | CACTVS 3.385 | OC(=O)C(=O)/C=C/C=C/c1ccc(cc1)[N+]([O-])=O | ACDLabs 12.01 | C(C([C@H]=C\C=C\c1ccc([N+](=O)[O-])cc1)=O)(O)=O |
|
Formula | C12 H9 N O5 |
Name | (3E,5E)-6-(4-nitrophenyl)-2-oxohexa-3,5-dienoic acid; 4-nitro-cinnamylidenepyruvate, bound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6eej Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|