Structure of PDB 6cd6 Chain C Binding Site BS01 |
|
|
Ligand ID | DXV |
InChI | InChI=1S/C25H22N2O2/c28-25(29)20-11-10-18(12-21(20)17-8-4-5-9-17)23-15-27-24-22(23)13-19(14-26-24)16-6-2-1-3-7-16/h1-3,6-7,10-15,17H,4-5,8-9H2,(H,26,27)(H,28,29) |
InChIKey | WVSBGSNVCDAMCF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1ccc(cc1C2CCCC2)c3c[nH]c4ncc(cc34)c5ccccc5 | ACDLabs 12.01 | C5CC(c4c(C(O)=O)ccc(c3c2cc(c1ccccc1)cnc2nc3)c4)CC5 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2cc3c(c[nH]c3nc2)c4ccc(c(c4)C5CCCC5)C(=O)O |
|
Formula | C25 H22 N2 O2 |
Name | 2-cyclopentyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
ChEMBL | CHEMBL558642 |
DrugBank | |
ZINC | ZINC000043015507
|
PDB chain | 6cd6 Chain C Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|