Structure of PDB 6caj Chain C Binding Site BS01 |
|
|
Ligand ID | C7B |
InChI | InChI=1S/C22H24Cl2N2O4/c23-15-1-9-19(10-2-15)29-13-21(27)25-17-5-7-18(8-6-17)26-22(28)14-30-20-11-3-16(24)4-12-20/h1-4,9-12,17-18H,5-8,13-14H2,(H,25,27)(H,26,28)/t17-,18- |
InChIKey | HJGMCDHQPXTGAV-IYARVYRRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc(OCC(=O)N[C@H]2CC[C@@H](CC2)NC(=O)COc3ccc(Cl)cc3)cc1 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1OCC(=O)NC2CCC(CC2)NC(=O)COc3ccc(cc3)Cl)Cl | CACTVS 3.385 | Clc1ccc(OCC(=O)N[CH]2CC[CH](CC2)NC(=O)COc3ccc(Cl)cc3)cc1 |
|
Formula | C22 H24 Cl2 N2 O4 |
Name | 2-(4-chloranylphenoxy)-~{N}-[4-[2-(4-chloranylphenoxy)ethanoylamino]cyclohexyl]ethanamide; ISRIB |
ChEMBL | CHEMBL4303573 |
DrugBank | |
ZINC |
|
PDB chain | 6caj Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|