Structure of PDB 5ura Chain C Binding Site BS01 |
|
|
Ligand ID | 8KS |
InChI | InChI=1S/C28H22O4/c29-27(30)25-23(19-11-3-1-4-12-19)26(24(25)20-13-5-2-6-14-20)28(31)32-22-17-9-15-18-10-7-8-16-21(18)22/h1-17,23-26H,(H,29,30)/t23-,24-,25-,26-/m0/s1 |
InChIKey | NVOKBONTLOAJKA-CQJMVLFOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)[C@H]1[C@@H]([C@@H]([C@H]1c2ccccc2)C(=O)Oc3cccc4ccccc34)c5ccccc5 | ACDLabs 12.01 | C3(C(Oc1cccc2ccccc12)=O)C(C(C(=O)O)C3c4ccccc4)c5ccccc5 | CACTVS 3.385 | OC(=O)[CH]1[CH]([CH]([CH]1c2ccccc2)C(=O)Oc3cccc4ccccc34)c5ccccc5 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2C(C(C2C(=O)Oc3cccc4c3cccc4)c5ccccc5)C(=O)O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[C@H]2C([C@@H](C2C(=O)Oc3cccc4c3cccc4)c5ccccc5)C(=O)O |
|
Formula | C28 H22 O4 |
Name | (1S,2S,3S,4S)-3-{[(naphthalen-1-yl)oxy]carbonyl}-2,4-diphenylcyclobutane-1-carboxylic acid |
ChEMBL | CHEMBL4281879 |
DrugBank | |
ZINC |
|
PDB chain | 5ura Chain C Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|