Structure of PDB 5ucj Chain C Binding Site BS01 |
|
|
Ligand ID | KU3 |
InChI | InChI=1S/C19H17FN2O3/c1-10(2)14-6-15(17(23)16-7-21-25-18(14)16)19(24)22-8-11-3-4-13(20)5-12(11)9-22/h3-7,10,23H,8-9H2,1-2H3 |
InChIKey | XKVXUSFQFBIYEQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)c1cc(c(c2c1onc2)O)C(=O)N3Cc4ccc(cc4C3)F | ACDLabs 12.01 | CC(C)c3cc(C(N1Cc2c(C1)ccc(c2)F)=O)c(O)c4c3onc4 | CACTVS 3.385 | CC(C)c1cc(c(O)c2cnoc12)C(=O)N3Cc4ccc(F)cc4C3 |
|
Formula | C19 H17 F N2 O3 |
Name | (5-fluoroisoindolin-2-yl)(4-hydroxy-5-isopropylbenzo[d]isoxazol-7-yl)methanone; (5-fluoro-1,3-dihydro-2H-isoindol-2-yl)[4-hydroxy-7-(propan-2-yl)-1,2-benzoxazol-5-yl]methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5ucj Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|