Structure of PDB 5uch Chain C Binding Site BS01 |
|
|
Ligand ID | 871 |
InChI | InChI=1S/C20H20N2O2/c1-13(2)17-10-18(19(23)9-14(17)7-8-21)20(24)22-11-15-5-3-4-6-16(15)12-22/h3-6,9-10,13,23H,7,11-12H2,1-2H3 |
InChIKey | BZEHHGZKLNMDRW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)c1cc(c(cc1CC#N)O)C(=O)N2Cc3ccccc3C2 | CACTVS 3.385 | CC(C)c1cc(c(O)cc1CC#N)C(=O)N2Cc3ccccc3C2 | ACDLabs 12.01 | c13ccccc1CN(C(c2cc(C(C)C)c(CC#N)cc2O)=O)C3 |
|
Formula | C20 H20 N2 O2 |
Name | 2-(5-Hydroxy-4-(isoindoline-2-carbonyl)-2-isopropylphenyl)acetonitrile; [4-(1,3-dihydro-2H-isoindole-2-carbonyl)-5-hydroxy-2-(propan-2-yl)phenyl]acetonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5uch Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|