Structure of PDB 5s5y Chain C Binding Site BS01 |
|
|
Ligand ID | W0A |
InChI | InChI=1S/C12H15N3O/c1-2-5-12(16)13-8-11-14-9-6-3-4-7-10(9)15-11/h3-4,6-7H,2,5,8H2,1H3,(H,13,16)(H,14,15) |
InChIKey | MXDONONSXPZRMO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n1c(CNC(=O)CCC)nc2c1cccc2 | CACTVS 3.385 OpenEye OEToolkits 2.0.7 | CCCC(=O)NCc1[nH]c2ccccc2n1 |
|
Formula | C12 H15 N3 O |
Name | N-[(1H-benzimidazol-2-yl)methyl]butanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000200671
|
PDB chain | 5s5y Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|